C22H20N2O3 — CID 110840980
[2-methoxy-4-[[(4-methylphenyl)hydrazinylidene]methyl]phenyl] benzoate (PubChem CID 110840980) has the molecular formula C22H20N2O3 and a molecular weight of 360.41 g/mol. Its IUPAC name is [2-methoxy-4-[[(4-methylphenyl)hydrazinylidene]methyl]phenyl] benzoate.
| Compound Name | [2-methoxy-4-[[(4-methylphenyl)hydrazinylidene]methyl]phenyl] benzoate |
|---|---|
| PubChem CID | 110840980 |
| Molecular Formula | C22H20N2O3 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | [2-methoxy-4-[[(4-methylphenyl)hydrazinylidene]methyl]phenyl] benzoate |
| SMILES | COc1cc(C=NNc2ccc(C)cc2)ccc1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H20N2O3/c1-16-8-11-19(12-9-16)24-23-15-17-10-13-20(21(14-17)26-2)27-22(25)18-6-4-3-5-7-18/h3-15,24H,1-2H3 |
| InChIKey | QNYMPYPTFFYLJV-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|