C34H28Cl2N4O8 — CID 4110059
[4-[[[4-[2-[[4-(4-chlorobenzoyl)oxy-3-methoxyphenyl]methylidene]hydrazinyl]-4-oxobutanoyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-chlorobenzoate (PubChem CID 4110059) has the molecular formula C34H28Cl2N4O8 and a molecular weight of 691.52 g/mol. Its IUPAC name is [4-[[[4-[2-[[4-(4-chlorobenzoyl)oxy-3-methoxyphenyl]methylidene]hydrazinyl]-4-oxobutanoyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-chlorobenzoate.
| Compound Name | [4-[[[4-[2-[[4-(4-chlorobenzoyl)oxy-3-methoxyphenyl]methylidene]hydrazinyl]-4-oxobutanoyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 4110059 |
| Molecular Formula | C34H28Cl2N4O8 |
| Molecular Weight | 691.52 g/mol |
| Exact Mass | 690.13 |
| IUPAC Name | [4-[[[4-[2-[[4-(4-chlorobenzoyl)oxy-3-methoxyphenyl]methylidene]hydrazinyl]-4-oxobutanoyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-chlorobenzoate |
| SMILES | COc1cc(C=NNC(=O)CCC(=O)NN=Cc2ccc(OC(=O)c3ccc(Cl)cc3)c(OC)c2)ccc1OC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C34H28Cl2N4O8/c1-45-29-17-21(3-13-27(29)47-33(43)23-5-9-25(35)10-6-23)19-37-39-31(41)15-16-32(42)40-38-20-22-4-14-28(30(18-22)46-2)48-34(44)24-7-11-26(36)12-8-24/h3-14,17-20H,15-16H2,1-2H3,(H,39,41)(H,40,42) |
| InChIKey | YFCPNEXRIVEINV-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 153.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.52 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|