C26H25ClN2O5 — CID 6061823
[2-methoxy-4-[(Z)-[[2-(4-propan-2-ylphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate (PubChem CID 6061823) has the molecular formula C26H25ClN2O5 and a molecular weight of 480.95 g/mol. Its IUPAC name is [2-methoxy-4-[(Z)-[[2-(4-propan-2-ylphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate.
| Compound Name | [2-methoxy-4-[(Z)-[[2-(4-propan-2-ylphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 6061823 |
| Molecular Formula | C26H25ClN2O5 |
| Molecular Weight | 480.95 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | [2-methoxy-4-[(Z)-[[2-(4-propan-2-ylphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
| SMILES | COc1cc(/C=N\NC(=O)COc2ccc(C(C)C)cc2)ccc1OC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H25ClN2O5/c1-17(2)19-7-11-22(12-8-19)33-16-25(30)29-28-15-18-4-13-23(24(14-18)32-3)34-26(31)20-5-9-21(27)10-6-20/h4-15,17H,16H2,1-3H3,(H,29,30)/b28-15- |
| InChIKey | BRXBBNGIRCZCMB-MBTHVWNTSA-N |
| XLogP | 5.22 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.95 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|