C27H21ClN2O5 — CID 4534440
[2-methoxy-4-[[(2-naphthalen-1-yloxyacetyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzoate (PubChem CID 4534440) has the molecular formula C27H21ClN2O5 and a molecular weight of 488.93 g/mol. Its IUPAC name is [2-methoxy-4-[[(2-naphthalen-1-yloxyacetyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzoate.
| Compound Name | [2-methoxy-4-[[(2-naphthalen-1-yloxyacetyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 4534440 |
| Molecular Formula | C27H21ClN2O5 |
| Molecular Weight | 488.93 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | [2-methoxy-4-[[(2-naphthalen-1-yloxyacetyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
| SMILES | COc1cc(C=NNC(=O)COc2cccc3ccccc23)ccc1OC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H21ClN2O5/c1-33-25-15-18(9-14-24(25)35-27(32)20-10-12-21(28)13-11-20)16-29-30-26(31)17-34-23-8-4-6-19-5-2-3-7-22(19)23/h2-16H,17H2,1H3,(H,30,31) |
| InChIKey | QUWIISONJPWKNY-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.93 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|