C15H18O4 — CID 4504529
(4-formyl-2-methoxyphenyl) cyclohexanecarboxylate (PubChem CID 4504529) has the molecular formula C15H18O4 and a molecular weight of 262.31 g/mol. Its IUPAC name is (4-formyl-2-methoxyphenyl) cyclohexanecarboxylate.
| Compound Name | (4-formyl-2-methoxyphenyl) cyclohexanecarboxylate |
|---|---|
| PubChem CID | 4504529 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | (4-formyl-2-methoxyphenyl) cyclohexanecarboxylate |
| SMILES | COc1cc(C=O)ccc1OC(=O)C1CCCCC1 |
| InChI | InChI=1S/C15H18O4/c1-18-14-9-11(10-16)7-8-13(14)19-15(17)12-5-3-2-4-6-12/h7-10,12H,2-6H2,1H3 |
| InChIKey | YCEBTYIAJWTZQH-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|