(4-formyl-2-methoxyphenyl) cyclohexanecarboxylate

C15H18O4 — CID 4504529

IUPAC(4-formyl-2-methoxyphenyl) cyclohexanecarboxylate
SMILESCOc1cc(C=O)ccc1OC(=O)C1CCCCC1
InChIInChI=1S/C15H18O4/c1-18-14-9-11(10-16)7-8-13(14)19-15(17)12-5-3-2-4-6-12/h7-10,12H,2-6H2,1H3
InChIKeyYCEBTYIAJWTZQH-UHFFFAOYSA-N
MW262.31 g/mol
LogP2.99
Rot. Bonds4

About (4-formyl-2-methoxyphenyl) cyclohexanecarboxylate

(4-formyl-2-methoxyphenyl) cyclohexanecarboxylate (PubChem CID 4504529) has the molecular formula C15H18O4 and a molecular weight of 262.31 g/mol. Its IUPAC name is (4-formyl-2-methoxyphenyl) cyclohexanecarboxylate.

Molecular Properties

Compound Name(4-formyl-2-methoxyphenyl) cyclohexanecarboxylate
PubChem CID4504529
Molecular FormulaC15H18O4
Molecular Weight262.31 g/mol
Exact Mass262.12
IUPAC Name(4-formyl-2-methoxyphenyl) cyclohexanecarboxylate
SMILESCOc1cc(C=O)ccc1OC(=O)C1CCCCC1
InChIInChI=1S/C15H18O4/c1-18-14-9-11(10-16)7-8-13(14)19-15(17)12-5-3-2-4-6-12/h7-10,12H,2-6H2,1H3
InChIKeyYCEBTYIAJWTZQH-UHFFFAOYSA-N
XLogP2.99
TPSA52.60 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500262.31
LogP ≤ 52.99
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}

Analyze (4-formyl-2-methoxyphenyl) cyclohexanecarboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4-formyl-2-methoxyphenyl) cyclohexanecarboxylate?
The IUPAC name of (4-formyl-2-methoxyphenyl) cyclohexanecarboxylate (CID 4504529) is (4-formyl-2-methoxyphenyl) cyclohexanecarboxylate.
What is the SMILES notation for (4-formyl-2-methoxyphenyl) cyclohexanecarboxylate?
The canonical SMILES for (4-formyl-2-methoxyphenyl) cyclohexanecarboxylate is COc1cc(C=O)ccc1OC(=O)C1CCCCC1.
What is the InChIKey of (4-formyl-2-methoxyphenyl) cyclohexanecarboxylate?
The InChIKey is YCEBTYIAJWTZQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18O4/c1-18-14-9-11(10-16)7-8-13(14)19-15(17)12-5-3-2-4-6-12/h7-10,12H,2-6H2,1H3.
What are the key properties of (4-formyl-2-methoxyphenyl) cyclohexanecarboxylate?
(4-formyl-2-methoxyphenyl) cyclohexanecarboxylate has a molecular weight of 262.31 g/mol, XLogP of 2.99, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-formyl-2-methoxyphenyl) cyclohexanecarboxylate is sourced from PubChem (CID 4504529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).