C16H15NO5S — CID 137405363
[4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenyl] cyclobutanecarboxylate (PubChem CID 137405363) has the molecular formula C16H15NO5S and a molecular weight of 333.37 g/mol. Its IUPAC name is [4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenyl] cyclobutanecarboxylate.
| Compound Name | [4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenyl] cyclobutanecarboxylate |
|---|---|
| PubChem CID | 137405363 |
| Molecular Formula | C16H15NO5S |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | [4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenyl] cyclobutanecarboxylate |
| SMILES | COc1cc(C=C2SC(=O)NC2=O)ccc1OC(=O)C1CCC1 |
| InChI | InChI=1S/C16H15NO5S/c1-21-12-7-9(8-13-14(18)17-16(20)23-13)5-6-11(12)22-15(19)10-3-2-4-10/h5-8,10H,2-4H2,1H3,(H,17,18,20) |
| InChIKey | NMCNOUUCVGLMDJ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|