C12H11NO6S2 — CID 50871142
[4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenyl] methanesulfonate (PubChem CID 50871142) has the molecular formula C12H11NO6S2 and a molecular weight of 329.36 g/mol. Its IUPAC name is [4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenyl] methanesulfonate.
| Compound Name | [4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenyl] methanesulfonate |
|---|---|
| PubChem CID | 50871142 |
| Molecular Formula | C12H11NO6S2 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.00 |
| IUPAC Name | [4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenyl] methanesulfonate |
| SMILES | COc1cc(/C=C2/SC(=O)NC2=O)ccc1OS(C)(=O)=O |
| InChI | InChI=1S/C12H11NO6S2/c1-18-9-5-7(3-4-8(9)19-21(2,16)17)6-10-11(14)13-12(15)20-10/h3-6H,1-2H3,(H,13,14,15)/b10-6+ |
| InChIKey | IRJDMXCQRXHIRE-UXBLZVDNSA-N |
| XLogP | 1.36 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|