C18H14BrNO6S2 — CID 87380939
(5E)-5-[[4-(2-bromo-4-methylsulfonylphenoxy)-3-methoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 87380939) has the molecular formula C18H14BrNO6S2 and a molecular weight of 484.35 g/mol. Its IUPAC name is (5E)-5-[[4-(2-bromo-4-methylsulfonylphenoxy)-3-methoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[4-(2-bromo-4-methylsulfonylphenoxy)-3-methoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 87380939 |
| Molecular Formula | C18H14BrNO6S2 |
| Molecular Weight | 484.35 g/mol |
| Exact Mass | 482.94 |
| IUPAC Name | (5E)-5-[[4-(2-bromo-4-methylsulfonylphenoxy)-3-methoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1cc(/C=C2/SC(=O)NC2=O)ccc1Oc1ccc(S(C)(=O)=O)cc1Br |
| InChI | InChI=1S/C18H14BrNO6S2/c1-25-15-7-10(8-16-17(21)20-18(22)27-16)3-5-14(15)26-13-6-4-11(9-12(13)19)28(2,23)24/h3-9H,1-2H3,(H,20,21,22)/b16-8+ |
| InChIKey | VCAMXWZDDPBUKM-LZYBPNLTSA-N |
| XLogP | 3.98 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.35 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|