C16H10N2O7S2 — CID 16627391
[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenyl] (2E)-2-(2,4-dioxo-1,3-thiazolidin-5-ylidene)acetate (PubChem CID 16627391) has the molecular formula C16H10N2O7S2 and a molecular weight of 406.40 g/mol. Its IUPAC name is [4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenyl] (2E)-2-(2,4-dioxo-1,3-thiazolidin-5-ylidene)acetate.
| Compound Name | [4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenyl] (2E)-2-(2,4-dioxo-1,3-thiazolidin-5-ylidene)acetate |
|---|---|
| PubChem CID | 16627391 |
| Molecular Formula | C16H10N2O7S2 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 405.99 |
| IUPAC Name | [4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenyl] (2E)-2-(2,4-dioxo-1,3-thiazolidin-5-ylidene)acetate |
| SMILES | COc1cc(/C=C2\SC(=O)NC2=O)ccc1OC(=O)/C=C1/SC(=O)NC1=O |
| InChI | InChI=1S/C16H10N2O7S2/c1-24-9-4-7(5-10-13(20)17-15(22)26-10)2-3-8(9)25-12(19)6-11-14(21)18-16(23)27-11/h2-6H,1H3,(H,17,20,22)(H,18,21,23)/b10-5-,11-6+ |
| InChIKey | LOABCQOJZKYBNA-JZKFVHIFSA-N |
| XLogP | 1.79 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|