C13H11NO5S — CID 11130135
methyl 5-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-methoxybenzoate (PubChem CID 11130135) has the molecular formula C13H11NO5S and a molecular weight of 293.30 g/mol. Its IUPAC name is methyl 5-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-methoxybenzoate.
| Compound Name | methyl 5-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-methoxybenzoate |
|---|---|
| PubChem CID | 11130135 |
| Molecular Formula | C13H11NO5S |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | methyl 5-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-methoxybenzoate |
| SMILES | COC(=O)c1cc(/C=C2/SC(=O)NC2=O)ccc1OC |
| InChI | InChI=1S/C13H11NO5S/c1-18-9-4-3-7(5-8(9)12(16)19-2)6-10-11(15)14-13(17)20-10/h3-6H,1-2H3,(H,14,15,17)/b10-6+ |
| InChIKey | UOERQDNMYPQTSZ-UXBLZVDNSA-N |
| XLogP | 1.81 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|