C19H14N2O8S — CID 11582785
methyl 4-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenoxy]-3-nitrobenzoate (PubChem CID 11582785) has the molecular formula C19H14N2O8S and a molecular weight of 430.39 g/mol. Its IUPAC name is methyl 4-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenoxy]-3-nitrobenzoate.
| Compound Name | methyl 4-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenoxy]-3-nitrobenzoate |
|---|---|
| PubChem CID | 11582785 |
| Molecular Formula | C19H14N2O8S |
| Molecular Weight | 430.39 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | methyl 4-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenoxy]-3-nitrobenzoate |
| SMILES | COC(=O)c1ccc(Oc2ccc(/C=C3\SC(=O)NC3=O)cc2OC)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H14N2O8S/c1-27-15-7-10(8-16-17(22)20-19(24)30-16)3-5-14(15)29-13-6-4-11(18(23)28-2)9-12(13)21(25)26/h3-9H,1-2H3,(H,20,22,24)/b16-8- |
| InChIKey | ULYXEPBWPBZBRQ-PXNMLYILSA-N |
| XLogP | 3.51 |
| TPSA | 134.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|