C19H14N2O7S — CID 162657840
methyl 4-[[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-nitrophenoxy]methyl]benzoate (PubChem CID 162657840) has the molecular formula C19H14N2O7S and a molecular weight of 414.40 g/mol. Its IUPAC name is methyl 4-[[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-nitrophenoxy]methyl]benzoate.
| Compound Name | methyl 4-[[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-nitrophenoxy]methyl]benzoate |
|---|---|
| PubChem CID | 162657840 |
| Molecular Formula | C19H14N2O7S |
| Molecular Weight | 414.40 g/mol |
| Exact Mass | 414.05 |
| IUPAC Name | methyl 4-[[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-nitrophenoxy]methyl]benzoate |
| SMILES | COC(=O)c1ccc(COc2ccc(/C=C3\SC(=O)NC3=O)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H14N2O7S/c1-27-18(23)13-5-2-11(3-6-13)10-28-15-7-4-12(8-14(15)21(25)26)9-16-17(22)20-19(24)29-16/h2-9H,10H2,1H3,(H,20,22,24)/b16-9- |
| InChIKey | YMRSGIFRCOKELP-SXGWCWSVSA-N |
| XLogP | 3.28 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.40 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|