C22H19NO7S2 — CID 18532717
2-[(5E)-5-[[3-methoxy-4-[(4-methoxycarbonylphenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 18532717) has the molecular formula C22H19NO7S2 and a molecular weight of 473.53 g/mol. Its IUPAC name is 2-[(5E)-5-[[3-methoxy-4-[(4-methoxycarbonylphenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(5E)-5-[[3-methoxy-4-[(4-methoxycarbonylphenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 18532717 |
| Molecular Formula | C22H19NO7S2 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.06 |
| IUPAC Name | 2-[(5E)-5-[[3-methoxy-4-[(4-methoxycarbonylphenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | COC(=O)c1ccc(COc2ccc(/C=C3/SC(=S)N(CC(=O)O)C3=O)cc2OC)cc1 |
| InChI | InChI=1S/C22H19NO7S2/c1-28-17-9-14(10-18-20(26)23(11-19(24)25)22(31)32-18)5-8-16(17)30-12-13-3-6-15(7-4-13)21(27)29-2/h3-10H,11-12H2,1-2H3,(H,24,25)/b18-10+ |
| InChIKey | LTUGQUNYMVHWSZ-VCHYOVAHSA-N |
| XLogP | 3.35 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|