C13H10INO4S2 — CID 126338285
2-[(5E)-5-[(3-iodo-4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 126338285) has the molecular formula C13H10INO4S2 and a molecular weight of 435.26 g/mol. Its IUPAC name is 2-[(5E)-5-[(3-iodo-4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(5E)-5-[(3-iodo-4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 126338285 |
| Molecular Formula | C13H10INO4S2 |
| Molecular Weight | 435.26 g/mol |
| Exact Mass | 434.91 |
| IUPAC Name | 2-[(5E)-5-[(3-iodo-4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | COc1ccc(/C=C2/SC(=S)N(CC(=O)O)C2=O)cc1I |
| InChI | InChI=1S/C13H10INO4S2/c1-19-9-3-2-7(4-8(9)14)5-10-12(18)15(6-11(16)17)13(20)21-10/h2-5H,6H2,1H3,(H,16,17)/b10-5+ |
| InChIKey | POLQWEOIFCGHTO-BJMVGYQFSA-N |
| XLogP | 2.59 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.26 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|