C40H48N4O10S2 — CID 159529420
5-[[4-(2-cyclohexylbutoxy)-3-nitrophenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 159529420) has the molecular formula C40H48N4O10S2 and a molecular weight of 808.98 g/mol. Its IUPAC name is 5-[[4-(2-cyclohexylbutoxy)-3-nitrophenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-(2-cyclohexylbutoxy)-3-nitrophenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 159529420 |
| Molecular Formula | C40H48N4O10S2 |
| Molecular Weight | 808.98 g/mol |
| Exact Mass | 808.28 |
| IUPAC Name | 5-[[4-(2-cyclohexylbutoxy)-3-nitrophenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CCC(COc1ccc(C=C2SC(=O)NC2=O)cc1[N+](=O)[O-])C1CCCCC1.CCC(COc1ccc(C=C2SC(=O)NC2=O)cc1[N+](=O)[O-])C1CCCCC1 |
| InChI | InChI=1S/2C20H24N2O5S/c2*1-2-14(15-6-4-3-5-7-15)12-27-17-9-8-13(10-16(17)22(25)26)11-18-19(23)21-20(24)28-18/h2*8-11,14-15H,2-7,12H2,1H3,(H,21,23,24) |
| InChIKey | MCULFEYMKBMKPN-UHFFFAOYSA-N |
| XLogP | 9.81 |
| TPSA | 197.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.98 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|