C40H50N2O6S2 — CID 158310283
5-[[4-(2-cyclohexylpropoxy)-3-methylphenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 158310283) has the molecular formula C40H50N2O6S2 and a molecular weight of 718.98 g/mol. Its IUPAC name is 5-[[4-(2-cyclohexylpropoxy)-3-methylphenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-(2-cyclohexylpropoxy)-3-methylphenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 158310283 |
| Molecular Formula | C40H50N2O6S2 |
| Molecular Weight | 718.98 g/mol |
| Exact Mass | 718.31 |
| IUPAC Name | 5-[[4-(2-cyclohexylpropoxy)-3-methylphenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1cc(C=C2SC(=O)NC2=O)ccc1OCC(C)C1CCCCC1.Cc1cc(C=C2SC(=O)NC2=O)ccc1OCC(C)C1CCCCC1 |
| InChI | InChI=1S/2C20H25NO3S/c2*1-13-10-15(11-18-19(22)21-20(23)25-18)8-9-17(13)24-12-14(2)16-6-4-3-5-7-16/h2*8-11,14,16H,3-7,12H2,1-2H3,(H,21,22,23) |
| InChIKey | GNPFKWJURUWHIL-UHFFFAOYSA-N |
| XLogP | 9.83 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.98 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|