C16H9N3O7S — CID 6524395
(5E)-5-[[3-(2,4-dinitrophenoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 6524395) has the molecular formula C16H9N3O7S and a molecular weight of 387.33 g/mol. Its IUPAC name is (5E)-5-[[3-(2,4-dinitrophenoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[3-(2,4-dinitrophenoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 6524395 |
| Molecular Formula | C16H9N3O7S |
| Molecular Weight | 387.33 g/mol |
| Exact Mass | 387.02 |
| IUPAC Name | (5E)-5-[[3-(2,4-dinitrophenoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C\c2cccc(Oc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])c2)S1 |
| InChI | InChI=1S/C16H9N3O7S/c20-15-14(27-16(21)17-15)7-9-2-1-3-11(6-9)26-13-5-4-10(18(22)23)8-12(13)19(24)25/h1-8H,(H,17,20,21)/b14-7+ |
| InChIKey | RPNVRKFDKAKHES-VGOFMYFVSA-N |
| XLogP | 3.62 |
| TPSA | 141.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.33 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|