C23H16N4O7 — CID 126205934
(5E)-3-benzyl-5-[[3-(2,4-dinitrophenoxy)phenyl]methylidene]imidazolidine-2,4-dione (PubChem CID 126205934) has the molecular formula C23H16N4O7 and a molecular weight of 460.40 g/mol. Its IUPAC name is (5E)-3-benzyl-5-[[3-(2,4-dinitrophenoxy)phenyl]methylidene]imidazolidine-2,4-dione.
| Compound Name | (5E)-3-benzyl-5-[[3-(2,4-dinitrophenoxy)phenyl]methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126205934 |
| Molecular Formula | C23H16N4O7 |
| Molecular Weight | 460.40 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | (5E)-3-benzyl-5-[[3-(2,4-dinitrophenoxy)phenyl]methylidene]imidazolidine-2,4-dione |
| SMILES | O=C1N/C(=C/c2cccc(Oc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])c2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C23H16N4O7/c28-22-19(24-23(29)25(22)14-15-5-2-1-3-6-15)12-16-7-4-8-18(11-16)34-21-10-9-17(26(30)31)13-20(21)27(32)33/h1-13H,14H2,(H,24,29)/b19-12+ |
| InChIKey | JFTVYEKSUNABGE-XDHOZWIPSA-N |
| XLogP | 4.39 |
| TPSA | 144.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.40 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|