C24H17Br2N3O5 — CID 126244712
(5E)-3-benzyl-5-[[3,5-dibromo-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]imidazolidine-2,4-dione (PubChem CID 126244712) has the molecular formula C24H17Br2N3O5 and a molecular weight of 587.22 g/mol. Its IUPAC name is (5E)-3-benzyl-5-[[3,5-dibromo-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]imidazolidine-2,4-dione.
| Compound Name | (5E)-3-benzyl-5-[[3,5-dibromo-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126244712 |
| Molecular Formula | C24H17Br2N3O5 |
| Molecular Weight | 587.22 g/mol |
| Exact Mass | 584.95 |
| IUPAC Name | (5E)-3-benzyl-5-[[3,5-dibromo-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]imidazolidine-2,4-dione |
| SMILES | O=C1N/C(=C/c2cc(Br)c(OCc3cccc([N+](=O)[O-])c3)c(Br)c2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C24H17Br2N3O5/c25-19-10-17(11-20(26)22(19)34-14-16-7-4-8-18(9-16)29(32)33)12-21-23(30)28(24(31)27-21)13-15-5-2-1-3-6-15/h1-12H,13-14H2,(H,27,31)/b21-12+ |
| InChIKey | DTOAJEWHDWXIHZ-CIAFOILYSA-N |
| XLogP | 5.79 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.22 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|