C23H21Br2N3O5 — CID 126084456
(5Z)-3-cyclohexyl-5-[[3,5-dibromo-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]imidazolidine-2,4-dione (PubChem CID 126084456) has the molecular formula C23H21Br2N3O5 and a molecular weight of 579.25 g/mol. Its IUPAC name is (5Z)-3-cyclohexyl-5-[[3,5-dibromo-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]imidazolidine-2,4-dione.
| Compound Name | (5Z)-3-cyclohexyl-5-[[3,5-dibromo-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126084456 |
| Molecular Formula | C23H21Br2N3O5 |
| Molecular Weight | 579.25 g/mol |
| Exact Mass | 576.98 |
| IUPAC Name | (5Z)-3-cyclohexyl-5-[[3,5-dibromo-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]imidazolidine-2,4-dione |
| SMILES | O=C1N/C(=C\c2cc(Br)c(OCc3cccc([N+](=O)[O-])c3)c(Br)c2)C(=O)N1C1CCCCC1 |
| InChI | InChI=1S/C23H21Br2N3O5/c24-18-10-15(12-20-22(29)27(23(30)26-20)16-6-2-1-3-7-16)11-19(25)21(18)33-13-14-5-4-8-17(9-14)28(31)32/h4-5,8-12,16H,1-3,6-7,13H2,(H,26,30)/b20-12- |
| InChIKey | HQBFDMVFDATMIS-NDENLUEZSA-N |
| XLogP | 5.92 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.25 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|