C26H27BrN2O5 — CID 3498329
5-[[3-bromo-5-methoxy-4-[(3-methylphenyl)methoxy]phenyl]methylidene]-1-cyclohexyl-1,3-diazinane-2,4,6-trione (PubChem CID 3498329) has the molecular formula C26H27BrN2O5 and a molecular weight of 527.42 g/mol. Its IUPAC name is 5-[[3-bromo-5-methoxy-4-[(3-methylphenyl)methoxy]phenyl]methylidene]-1-cyclohexyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[[3-bromo-5-methoxy-4-[(3-methylphenyl)methoxy]phenyl]methylidene]-1-cyclohexyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 3498329 |
| Molecular Formula | C26H27BrN2O5 |
| Molecular Weight | 527.42 g/mol |
| Exact Mass | 526.11 |
| IUPAC Name | 5-[[3-bromo-5-methoxy-4-[(3-methylphenyl)methoxy]phenyl]methylidene]-1-cyclohexyl-1,3-diazinane-2,4,6-trione |
| SMILES | COc1cc(C=C2C(=O)NC(=O)N(C3CCCCC3)C2=O)cc(Br)c1OCc1cccc(C)c1 |
| InChI | InChI=1S/C26H27BrN2O5/c1-16-7-6-8-17(11-16)15-34-23-21(27)13-18(14-22(23)33-2)12-20-24(30)28-26(32)29(25(20)31)19-9-4-3-5-10-19/h6-8,11-14,19H,3-5,9-10,15H2,1-2H3,(H,28,30,32) |
| InChIKey | JXCQIDXMNHZQAA-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.42 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|