C25H23BrN2O6 — CID 3544077
3-[[2-bromo-4-[(1-cyclohexyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]methyl]benzoic acid (PubChem CID 3544077) has the molecular formula C25H23BrN2O6 and a molecular weight of 527.37 g/mol. Its IUPAC name is 3-[[2-bromo-4-[(1-cyclohexyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]methyl]benzoic acid.
| Compound Name | 3-[[2-bromo-4-[(1-cyclohexyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 3544077 |
| Molecular Formula | C25H23BrN2O6 |
| Molecular Weight | 527.37 g/mol |
| Exact Mass | 526.07 |
| IUPAC Name | 3-[[2-bromo-4-[(1-cyclohexyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]methyl]benzoic acid |
| SMILES | O=C1NC(=O)N(C2CCCCC2)C(=O)C1=Cc1ccc(OCc2cccc(C(=O)O)c2)c(Br)c1 |
| InChI | InChI=1S/C25H23BrN2O6/c26-20-13-15(9-10-21(20)34-14-16-5-4-6-17(11-16)24(31)32)12-19-22(29)27-25(33)28(23(19)30)18-7-2-1-3-8-18/h4-6,9-13,18H,1-3,7-8,14H2,(H,31,32)(H,27,29,33) |
| InChIKey | JJNPAUDSUWGDFG-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.37 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|