C24H21BrCl2N2O4 — CID 4042913
5-[[3-bromo-4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-1-cyclohexyl-1,3-diazinane-2,4,6-trione (PubChem CID 4042913) has the molecular formula C24H21BrCl2N2O4 and a molecular weight of 552.25 g/mol. Its IUPAC name is 5-[[3-bromo-4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-1-cyclohexyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[[3-bromo-4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-1-cyclohexyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 4042913 |
| Molecular Formula | C24H21BrCl2N2O4 |
| Molecular Weight | 552.25 g/mol |
| Exact Mass | 550.01 |
| IUPAC Name | 5-[[3-bromo-4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-1-cyclohexyl-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)N(C2CCCCC2)C(=O)C1=Cc1ccc(OCc2ccc(Cl)c(Cl)c2)c(Br)c1 |
| InChI | InChI=1S/C24H21BrCl2N2O4/c25-18-11-14(7-9-21(18)33-13-15-6-8-19(26)20(27)12-15)10-17-22(30)28-24(32)29(23(17)31)16-4-2-1-3-5-16/h6-12,16H,1-5,13H2,(H,28,30,32) |
| InChIKey | FDKVFDDKKVQHBQ-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.25 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|