C30H29BrN2O5 — CID 3707640
5-[[3-bromo-5-ethoxy-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-1-cyclohexyl-1,3-diazinane-2,4,6-trione (PubChem CID 3707640) has the molecular formula C30H29BrN2O5 and a molecular weight of 577.48 g/mol. Its IUPAC name is 5-[[3-bromo-5-ethoxy-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-1-cyclohexyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[[3-bromo-5-ethoxy-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-1-cyclohexyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 3707640 |
| Molecular Formula | C30H29BrN2O5 |
| Molecular Weight | 577.48 g/mol |
| Exact Mass | 576.13 |
| IUPAC Name | 5-[[3-bromo-5-ethoxy-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-1-cyclohexyl-1,3-diazinane-2,4,6-trione |
| SMILES | CCOc1cc(C=C2C(=O)NC(=O)N(C3CCCCC3)C2=O)cc(Br)c1OCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C30H29BrN2O5/c1-2-37-26-17-20(15-24-28(34)32-30(36)33(29(24)35)23-10-4-3-5-11-23)16-25(31)27(26)38-18-19-12-13-21-8-6-7-9-22(21)14-19/h6-9,12-17,23H,2-5,10-11,18H2,1H3,(H,32,34,36) |
| InChIKey | MVFUQOLESXGCAJ-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.48 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|