C26H27BrCl2N2O3S — CID 126084378
(5Z)-5-[[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-3-cyclohexyl-1-methyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 126084378) has the molecular formula C26H27BrCl2N2O3S and a molecular weight of 598.39 g/mol. Its IUPAC name is (5Z)-5-[[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-3-cyclohexyl-1-methyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-3-cyclohexyl-1-methyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 126084378 |
| Molecular Formula | C26H27BrCl2N2O3S |
| Molecular Weight | 598.39 g/mol |
| Exact Mass | 596.03 |
| IUPAC Name | (5Z)-5-[[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-3-cyclohexyl-1-methyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCOc1cc(/C=C2/C(=O)N(C3CCCCC3)C(=S)N2C)cc(Br)c1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C26H27BrCl2N2O3S/c1-3-33-23-14-17(11-19(27)24(23)34-15-16-9-10-20(28)21(29)12-16)13-22-25(32)31(26(35)30(22)2)18-7-5-4-6-8-18/h9-14,18H,3-8,15H2,1-2H3/b22-13- |
| InChIKey | HAZRXWLLHCAIAT-XKZIYDEJSA-N |
| XLogP | 7.47 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.39 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|