C25H19BrCl2N2O3S — CID 126043901
(5Z)-5-[[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-1-methyl-3-phenyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 126043901) has the molecular formula C25H19BrCl2N2O3S and a molecular weight of 578.32 g/mol. Its IUPAC name is (5Z)-5-[[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-1-methyl-3-phenyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-1-methyl-3-phenyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 126043901 |
| Molecular Formula | C25H19BrCl2N2O3S |
| Molecular Weight | 578.32 g/mol |
| Exact Mass | 575.97 |
| IUPAC Name | (5Z)-5-[[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-1-methyl-3-phenyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | COc1cc(/C=C2/C(=O)N(c3ccccc3)C(=S)N2C)cc(Br)c1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C25H19BrCl2N2O3S/c1-29-21(24(31)30(25(29)34)17-6-4-3-5-7-17)12-16-10-18(26)23(22(13-16)32-2)33-14-15-8-9-19(27)20(28)11-15/h3-13H,14H2,1-2H3/b21-12- |
| InChIKey | CRBYCTMNQPCPHF-MTJSOVHGSA-N |
| XLogP | 6.95 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.32 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|