C31H21BrCl2N2O4S — CID 50873479
5-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-1,3-diphenyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 50873479) has the molecular formula C31H21BrCl2N2O4S and a molecular weight of 668.40 g/mol. Its IUPAC name is 5-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-1,3-diphenyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-1,3-diphenyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 50873479 |
| Molecular Formula | C31H21BrCl2N2O4S |
| Molecular Weight | 668.40 g/mol |
| Exact Mass | 665.98 |
| IUPAC Name | 5-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-1,3-diphenyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | COc1cc(C=C2C(=O)N(c3ccccc3)C(=S)N(c3ccccc3)C2=O)cc(Br)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C31H21BrCl2N2O4S/c1-39-27-16-19(15-25(32)28(27)40-18-20-12-13-21(33)17-26(20)34)14-24-29(37)35(22-8-4-2-5-9-22)31(41)36(30(24)38)23-10-6-3-7-11-23/h2-17H,18H2,1H3 |
| InChIKey | GINFKLIRDMBEJR-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.40 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|