C27H24BrClN2O4S — CID 126051047
(5Z)-5-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-3-(4-ethoxyphenyl)-1-methyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 126051047) has the molecular formula C27H24BrClN2O4S and a molecular weight of 587.92 g/mol. Its IUPAC name is (5Z)-5-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-3-(4-ethoxyphenyl)-1-methyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-3-(4-ethoxyphenyl)-1-methyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 126051047 |
| Molecular Formula | C27H24BrClN2O4S |
| Molecular Weight | 587.92 g/mol |
| Exact Mass | 586.03 |
| IUPAC Name | (5Z)-5-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-3-(4-ethoxyphenyl)-1-methyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCOc1ccc(N2C(=O)/C(=C/c3cc(Br)c(OCc4ccccc4Cl)c(OC)c3)N(C)C2=S)cc1 |
| InChI | InChI=1S/C27H24BrClN2O4S/c1-4-34-20-11-9-19(10-12-20)31-26(32)23(30(2)27(31)36)14-17-13-21(28)25(24(15-17)33-3)35-16-18-7-5-6-8-22(18)29/h5-15H,4,16H2,1-3H3/b23-14- |
| InChIKey | OLOXOGLVBAVTRP-UCQKPKSFSA-N |
| XLogP | 6.69 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.92 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|