C27H24Cl2N2O4S — CID 126046718
(5Z)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-3-(4-ethoxyphenyl)-1-methyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 126046718) has the molecular formula C27H24Cl2N2O4S and a molecular weight of 543.47 g/mol. Its IUPAC name is (5Z)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-3-(4-ethoxyphenyl)-1-methyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-3-(4-ethoxyphenyl)-1-methyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 126046718 |
| Molecular Formula | C27H24Cl2N2O4S |
| Molecular Weight | 543.47 g/mol |
| Exact Mass | 542.08 |
| IUPAC Name | (5Z)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-3-(4-ethoxyphenyl)-1-methyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCOc1ccc(N2C(=O)/C(=C/c3ccc(OCc4ccc(Cl)cc4Cl)c(OC)c3)N(C)C2=S)cc1 |
| InChI | InChI=1S/C27H24Cl2N2O4S/c1-4-34-21-10-8-20(9-11-21)31-26(32)23(30(2)27(31)36)13-17-5-12-24(25(14-17)33-3)35-16-18-6-7-19(28)15-22(18)29/h5-15H,4,16H2,1-3H3/b23-13- |
| InChIKey | SVHYWCYRBVXASB-QRVIBDJDSA-N |
| XLogP | 6.58 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.47 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|