C26H21N3O3S — CID 126045986
2-[[2-methoxy-4-[(Z)-(3-methyl-5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-ylidene)methyl]phenoxy]methyl]benzonitrile (PubChem CID 126045986) has the molecular formula C26H21N3O3S and a molecular weight of 455.54 g/mol. Its IUPAC name is 2-[[2-methoxy-4-[(Z)-(3-methyl-5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-ylidene)methyl]phenoxy]methyl]benzonitrile.
| Compound Name | 2-[[2-methoxy-4-[(Z)-(3-methyl-5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-ylidene)methyl]phenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 126045986 |
| Molecular Formula | C26H21N3O3S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | 2-[[2-methoxy-4-[(Z)-(3-methyl-5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-ylidene)methyl]phenoxy]methyl]benzonitrile |
| SMILES | COc1cc(/C=C2/C(=O)N(c3ccccc3)C(=S)N2C)ccc1OCc1ccccc1C#N |
| InChI | InChI=1S/C26H21N3O3S/c1-28-22(25(30)29(26(28)33)21-10-4-3-5-11-21)14-18-12-13-23(24(15-18)31-2)32-17-20-9-7-6-8-19(20)16-27/h3-15H,17H2,1-2H3/b22-14- |
| InChIKey | GZXVLGCTPVMMRX-HMAPJEAMSA-N |
| XLogP | 4.75 |
| TPSA | 65.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|