C28H24IN3O4S — CID 126038492
2-[[4-[(Z)-[1-(4-ethoxyphenyl)-3-methyl-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]-2-iodo-6-methoxyphenoxy]methyl]benzonitrile (PubChem CID 126038492) has the molecular formula C28H24IN3O4S and a molecular weight of 625.49 g/mol. Its IUPAC name is 2-[[4-[(Z)-[1-(4-ethoxyphenyl)-3-methyl-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]-2-iodo-6-methoxyphenoxy]methyl]benzonitrile.
| Compound Name | 2-[[4-[(Z)-[1-(4-ethoxyphenyl)-3-methyl-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]-2-iodo-6-methoxyphenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 126038492 |
| Molecular Formula | C28H24IN3O4S |
| Molecular Weight | 625.49 g/mol |
| Exact Mass | 625.05 |
| IUPAC Name | 2-[[4-[(Z)-[1-(4-ethoxyphenyl)-3-methyl-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]-2-iodo-6-methoxyphenoxy]methyl]benzonitrile |
| SMILES | CCOc1ccc(N2C(=O)/C(=C/c3cc(I)c(OCc4ccccc4C#N)c(OC)c3)N(C)C2=S)cc1 |
| InChI | InChI=1S/C28H24IN3O4S/c1-4-35-22-11-9-21(10-12-22)32-27(33)24(31(2)28(32)37)14-18-13-23(29)26(25(15-18)34-3)36-17-20-8-6-5-7-19(20)16-30/h5-15H,4,17H2,1-3H3/b24-14- |
| InChIKey | IPMQCVZHKPCNBO-OYKKKHCWSA-N |
| XLogP | 5.75 |
| TPSA | 75.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.49 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|