C27H20IN3O6 — CID 3352957
2-[[2-iodo-6-methoxy-4-[[1-(4-methoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]methyl]benzonitrile (PubChem CID 3352957) has the molecular formula C27H20IN3O6 and a molecular weight of 609.38 g/mol. Its IUPAC name is 2-[[2-iodo-6-methoxy-4-[[1-(4-methoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]methyl]benzonitrile.
| Compound Name | 2-[[2-iodo-6-methoxy-4-[[1-(4-methoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 3352957 |
| Molecular Formula | C27H20IN3O6 |
| Molecular Weight | 609.38 g/mol |
| Exact Mass | 609.04 |
| IUPAC Name | 2-[[2-iodo-6-methoxy-4-[[1-(4-methoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]methyl]benzonitrile |
| SMILES | COc1ccc(N2C(=O)NC(=O)C(=Cc3cc(I)c(OCc4ccccc4C#N)c(OC)c3)C2=O)cc1 |
| InChI | InChI=1S/C27H20IN3O6/c1-35-20-9-7-19(8-10-20)31-26(33)21(25(32)30-27(31)34)11-16-12-22(28)24(23(13-16)36-2)37-15-18-6-4-3-5-17(18)14-29/h3-13H,15H2,1-2H3,(H,30,32,34) |
| InChIKey | PGSOEWHGVDMPKU-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 117.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.38 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|