C25H22INO6 — CID 124539352
2-[[4-[(2,4-dioxo-1,5-dioxaspiro[5.5]undecan-3-ylidene)methyl]-2-iodo-6-methoxyphenoxy]methyl]benzonitrile (PubChem CID 124539352) has the molecular formula C25H22INO6 and a molecular weight of 559.36 g/mol. Its IUPAC name is 2-[[4-[(2,4-dioxo-1,5-dioxaspiro[5.5]undecan-3-ylidene)methyl]-2-iodo-6-methoxyphenoxy]methyl]benzonitrile.
| Compound Name | 2-[[4-[(2,4-dioxo-1,5-dioxaspiro[5.5]undecan-3-ylidene)methyl]-2-iodo-6-methoxyphenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 124539352 |
| Molecular Formula | C25H22INO6 |
| Molecular Weight | 559.36 g/mol |
| Exact Mass | 559.05 |
| IUPAC Name | 2-[[4-[(2,4-dioxo-1,5-dioxaspiro[5.5]undecan-3-ylidene)methyl]-2-iodo-6-methoxyphenoxy]methyl]benzonitrile |
| SMILES | COc1cc(C=C2C(=O)OC3(CCCCC3)OC2=O)cc(I)c1OCc1ccccc1C#N |
| InChI | InChI=1S/C25H22INO6/c1-30-21-13-16(11-19-23(28)32-25(33-24(19)29)9-5-2-6-10-25)12-20(26)22(21)31-15-18-8-4-3-7-17(18)14-27/h3-4,7-8,11-13H,2,5-6,9-10,15H2,1H3 |
| InChIKey | MABRTMNSZWPVBI-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 94.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.36 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|