C25H24IN3O3S — CID 126088647
2-[[4-[(Z)-(1-cyclohexyl-5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]-2-iodo-6-methoxyphenoxy]methyl]benzonitrile (PubChem CID 126088647) has the molecular formula C25H24IN3O3S and a molecular weight of 573.46 g/mol. Its IUPAC name is 2-[[4-[(Z)-(1-cyclohexyl-5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]-2-iodo-6-methoxyphenoxy]methyl]benzonitrile.
| Compound Name | 2-[[4-[(Z)-(1-cyclohexyl-5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]-2-iodo-6-methoxyphenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 126088647 |
| Molecular Formula | C25H24IN3O3S |
| Molecular Weight | 573.46 g/mol |
| Exact Mass | 573.06 |
| IUPAC Name | 2-[[4-[(Z)-(1-cyclohexyl-5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]-2-iodo-6-methoxyphenoxy]methyl]benzonitrile |
| SMILES | COc1cc(/C=C2\NC(=S)N(C3CCCCC3)C2=O)cc(I)c1OCc1ccccc1C#N |
| InChI | InChI=1S/C25H24IN3O3S/c1-31-22-13-16(11-20(26)23(22)32-15-18-8-6-5-7-17(18)14-27)12-21-24(30)29(25(33)28-21)19-9-3-2-4-10-19/h5-8,11-13,19H,2-4,9-10,15H2,1H3,(H,28,33)/b21-12- |
| InChIKey | IUBUAOMPTNVLPB-MTJSOVHGSA-N |
| XLogP | 5.14 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.46 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|