C24H21IN2O4S2 — CID 126086283
2-[[2-iodo-6-methoxy-4-[(Z)-[4-oxo-3-[[(2R)-oxolan-2-yl]methyl]-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzonitrile (PubChem CID 126086283) has the molecular formula C24H21IN2O4S2 and a molecular weight of 592.48 g/mol. Its IUPAC name is 2-[[2-iodo-6-methoxy-4-[(Z)-[4-oxo-3-[[(2R)-oxolan-2-yl]methyl]-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzonitrile.
| Compound Name | 2-[[2-iodo-6-methoxy-4-[(Z)-[4-oxo-3-[[(2R)-oxolan-2-yl]methyl]-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 126086283 |
| Molecular Formula | C24H21IN2O4S2 |
| Molecular Weight | 592.48 g/mol |
| Exact Mass | 592.00 |
| IUPAC Name | 2-[[2-iodo-6-methoxy-4-[(Z)-[4-oxo-3-[[(2R)-oxolan-2-yl]methyl]-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzonitrile |
| SMILES | COc1cc(/C=C2\SC(=S)N(C[C@H]3CCCO3)C2=O)cc(I)c1OCc1ccccc1C#N |
| InChI | InChI=1S/C24H21IN2O4S2/c1-29-20-10-15(9-19(25)22(20)31-14-17-6-3-2-5-16(17)12-26)11-21-23(28)27(24(32)33-21)13-18-7-4-8-30-18/h2-3,5-6,9-11,18H,4,7-8,13-14H2,1H3/b21-11-/t18-/m1/s1 |
| InChIKey | KDQUTVXOQPVHOH-UTYYKHSJSA-N |
| XLogP | 5.13 |
| TPSA | 71.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.48 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|