C24H22IN3O3 — CID 126085115
2-[[4-[(Z)-(1-cyclohexyl-2,5-dioxoimidazolidin-4-ylidene)methyl]-2-iodophenoxy]methyl]benzonitrile (PubChem CID 126085115) has the molecular formula C24H22IN3O3 and a molecular weight of 527.36 g/mol. Its IUPAC name is 2-[[4-[(Z)-(1-cyclohexyl-2,5-dioxoimidazolidin-4-ylidene)methyl]-2-iodophenoxy]methyl]benzonitrile.
| Compound Name | 2-[[4-[(Z)-(1-cyclohexyl-2,5-dioxoimidazolidin-4-ylidene)methyl]-2-iodophenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 126085115 |
| Molecular Formula | C24H22IN3O3 |
| Molecular Weight | 527.36 g/mol |
| Exact Mass | 527.07 |
| IUPAC Name | 2-[[4-[(Z)-(1-cyclohexyl-2,5-dioxoimidazolidin-4-ylidene)methyl]-2-iodophenoxy]methyl]benzonitrile |
| SMILES | N#Cc1ccccc1COc1ccc(/C=C2\NC(=O)N(C3CCCCC3)C2=O)cc1I |
| InChI | InChI=1S/C24H22IN3O3/c25-20-12-16(10-11-22(20)31-15-18-7-5-4-6-17(18)14-26)13-21-23(29)28(24(30)27-21)19-8-2-1-3-9-19/h4-7,10-13,19H,1-3,8-9,15H2,(H,27,30)/b21-13- |
| InChIKey | IBKSVJDDSSCGJN-BKUYFWCQSA-N |
| XLogP | 4.97 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.36 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|