C25H13F5IN3O2 — CID 126037294
2-[[2-iodo-4-[(E)-[3-methyl-5-oxo-1-(2,3,4,5,6-pentafluorophenyl)pyrazol-4-ylidene]methyl]phenoxy]methyl]benzonitrile (PubChem CID 126037294) has the molecular formula C25H13F5IN3O2 and a molecular weight of 609.29 g/mol. Its IUPAC name is 2-[[2-iodo-4-[(E)-[3-methyl-5-oxo-1-(2,3,4,5,6-pentafluorophenyl)pyrazol-4-ylidene]methyl]phenoxy]methyl]benzonitrile.
| Compound Name | 2-[[2-iodo-4-[(E)-[3-methyl-5-oxo-1-(2,3,4,5,6-pentafluorophenyl)pyrazol-4-ylidene]methyl]phenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 126037294 |
| Molecular Formula | C25H13F5IN3O2 |
| Molecular Weight | 609.29 g/mol |
| Exact Mass | 609.00 |
| IUPAC Name | 2-[[2-iodo-4-[(E)-[3-methyl-5-oxo-1-(2,3,4,5,6-pentafluorophenyl)pyrazol-4-ylidene]methyl]phenoxy]methyl]benzonitrile |
| SMILES | CC1=NN(c2c(F)c(F)c(F)c(F)c2F)C(=O)/C1=C/c1ccc(OCc2ccccc2C#N)c(I)c1 |
| InChI | InChI=1S/C25H13F5IN3O2/c1-12-16(25(35)34(33-12)24-22(29)20(27)19(26)21(28)23(24)30)8-13-6-7-18(17(31)9-13)36-11-15-5-3-2-4-14(15)10-32/h2-9H,11H2,1H3/b16-8+ |
| InChIKey | FTGDXOJXRSMWDG-LZYBPNLTSA-N |
| XLogP | 6.24 |
| TPSA | 65.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.29 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|