C27H18ClF5N2O2 — CID 126035985
(4E)-4-[[4-[(4-chlorophenyl)methoxy]-3-prop-2-enylphenyl]methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one (PubChem CID 126035985) has the molecular formula C27H18ClF5N2O2 and a molecular weight of 532.90 g/mol. Its IUPAC name is (4E)-4-[[4-[(4-chlorophenyl)methoxy]-3-prop-2-enylphenyl]methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one.
| Compound Name | (4E)-4-[[4-[(4-chlorophenyl)methoxy]-3-prop-2-enylphenyl]methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one |
|---|---|
| PubChem CID | 126035985 |
| Molecular Formula | C27H18ClF5N2O2 |
| Molecular Weight | 532.90 g/mol |
| Exact Mass | 532.10 |
| IUPAC Name | (4E)-4-[[4-[(4-chlorophenyl)methoxy]-3-prop-2-enylphenyl]methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one |
| SMILES | C=CCc1cc(/C=C2/C(=O)N(c3c(F)c(F)c(F)c(F)c3F)N=C2C)ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H18ClF5N2O2/c1-3-4-17-11-16(7-10-20(17)37-13-15-5-8-18(28)9-6-15)12-19-14(2)34-35(27(19)36)26-24(32)22(30)21(29)23(31)25(26)33/h3,5-12H,1,4,13H2,2H3/b19-12+ |
| InChIKey | BLQPWVBWHUWOJB-XDHOZWIPSA-N |
| XLogP | 7.15 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.90 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|