C20H10ClF5N2O2 — CID 126046221
(4Z)-4-[(5-chloro-2-prop-2-ynoxyphenyl)methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one (PubChem CID 126046221) has the molecular formula C20H10ClF5N2O2 and a molecular weight of 440.76 g/mol. Its IUPAC name is (4Z)-4-[(5-chloro-2-prop-2-ynoxyphenyl)methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one.
| Compound Name | (4Z)-4-[(5-chloro-2-prop-2-ynoxyphenyl)methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one |
|---|---|
| PubChem CID | 126046221 |
| Molecular Formula | C20H10ClF5N2O2 |
| Molecular Weight | 440.76 g/mol |
| Exact Mass | 440.04 |
| IUPAC Name | (4Z)-4-[(5-chloro-2-prop-2-ynoxyphenyl)methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one |
| SMILES | C#CCOc1ccc(Cl)cc1/C=C1\C(=O)N(c2c(F)c(F)c(F)c(F)c2F)N=C1C |
| InChI | InChI=1S/C20H10ClF5N2O2/c1-3-6-30-13-5-4-11(21)7-10(13)8-12-9(2)27-28(20(12)29)19-17(25)15(23)14(22)16(24)18(19)26/h1,4-5,7-8H,6H2,2H3/b12-8- |
| InChIKey | SDZNRKNZDMEJOZ-WQLSENKSSA-N |
| XLogP | 4.85 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.76 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|