C24H13Br2F5N2O2 — CID 126044995
(4E)-4-[[5-bromo-2-[(4-bromophenyl)methoxy]phenyl]methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one (PubChem CID 126044995) has the molecular formula C24H13Br2F5N2O2 and a molecular weight of 616.18 g/mol. Its IUPAC name is (4E)-4-[[5-bromo-2-[(4-bromophenyl)methoxy]phenyl]methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one.
| Compound Name | (4E)-4-[[5-bromo-2-[(4-bromophenyl)methoxy]phenyl]methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one |
|---|---|
| PubChem CID | 126044995 |
| Molecular Formula | C24H13Br2F5N2O2 |
| Molecular Weight | 616.18 g/mol |
| Exact Mass | 613.93 |
| IUPAC Name | (4E)-4-[[5-bromo-2-[(4-bromophenyl)methoxy]phenyl]methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one |
| SMILES | CC1=NN(c2c(F)c(F)c(F)c(F)c2F)C(=O)/C1=C/c1cc(Br)ccc1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C24H13Br2F5N2O2/c1-11-16(24(34)33(32-11)23-21(30)19(28)18(27)20(29)22(23)31)9-13-8-15(26)6-7-17(13)35-10-12-2-4-14(25)5-3-12/h2-9H,10H2,1H3/b16-9+ |
| InChIKey | PIBPGEZRIGTIOB-CXUHLZMHSA-N |
| XLogP | 7.29 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.18 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|