C28H24F5N3O2 — CID 126038969
(4Z)-4-[[4-(diethylamino)-2-phenylmethoxyphenyl]methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one (PubChem CID 126038969) has the molecular formula C28H24F5N3O2 and a molecular weight of 529.51 g/mol. Its IUPAC name is (4Z)-4-[[4-(diethylamino)-2-phenylmethoxyphenyl]methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one.
| Compound Name | (4Z)-4-[[4-(diethylamino)-2-phenylmethoxyphenyl]methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one |
|---|---|
| PubChem CID | 126038969 |
| Molecular Formula | C28H24F5N3O2 |
| Molecular Weight | 529.51 g/mol |
| Exact Mass | 529.18 |
| IUPAC Name | (4Z)-4-[[4-(diethylamino)-2-phenylmethoxyphenyl]methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one |
| SMILES | CCN(CC)c1ccc(/C=C2\C(=O)N(c3c(F)c(F)c(F)c(F)c3F)N=C2C)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C28H24F5N3O2/c1-4-35(5-2)19-12-11-18(21(14-19)38-15-17-9-7-6-8-10-17)13-20-16(3)34-36(28(20)37)27-25(32)23(30)22(29)24(31)26(27)33/h6-14H,4-5,15H2,1-3H3/b20-13- |
| InChIKey | CLLMGUMGQHNZAP-MOSHPQCFSA-N |
| XLogP | 6.61 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.51 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|