C21H17F5N4O3 — CID 126035944
(4E)-4-[[2-(diethylamino)-5-nitrophenyl]methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one (PubChem CID 126035944) has the molecular formula C21H17F5N4O3 and a molecular weight of 468.38 g/mol. Its IUPAC name is (4E)-4-[[2-(diethylamino)-5-nitrophenyl]methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one.
| Compound Name | (4E)-4-[[2-(diethylamino)-5-nitrophenyl]methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one |
|---|---|
| PubChem CID | 126035944 |
| Molecular Formula | C21H17F5N4O3 |
| Molecular Weight | 468.38 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | (4E)-4-[[2-(diethylamino)-5-nitrophenyl]methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one |
| SMILES | CCN(CC)c1ccc([N+](=O)[O-])cc1/C=C1/C(=O)N(c2c(F)c(F)c(F)c(F)c2F)N=C1C |
| InChI | InChI=1S/C21H17F5N4O3/c1-4-28(5-2)14-7-6-12(30(32)33)8-11(14)9-13-10(3)27-29(21(13)31)20-18(25)16(23)15(22)17(24)19(20)26/h6-9H,4-5H2,1-3H3/b13-9+ |
| InChIKey | AMBIIAVXAFHLMK-UKTHLTGXSA-N |
| XLogP | 4.94 |
| TPSA | 79.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.38 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|