C25H13F5N2O — CID 126044957
(4E)-4-(anthracen-9-ylmethylidene)-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one (PubChem CID 126044957) has the molecular formula C25H13F5N2O and a molecular weight of 452.38 g/mol. Its IUPAC name is (4E)-4-(anthracen-9-ylmethylidene)-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one.
| Compound Name | (4E)-4-(anthracen-9-ylmethylidene)-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one |
|---|---|
| PubChem CID | 126044957 |
| Molecular Formula | C25H13F5N2O |
| Molecular Weight | 452.38 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | (4E)-4-(anthracen-9-ylmethylidene)-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one |
| SMILES | CC1=NN(c2c(F)c(F)c(F)c(F)c2F)C(=O)/C1=C/c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C25H13F5N2O/c1-12-17(25(33)32(31-12)24-22(29)20(27)19(26)21(28)23(24)30)11-18-15-8-4-2-6-13(15)10-14-7-3-5-9-16(14)18/h2-11H,1H3/b17-11+ |
| InChIKey | VXUDPUKELOGYLN-GZTJUZNOSA-N |
| XLogP | 6.49 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.38 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|