C28H19ClF5N3O — CID 126043508
(4E)-4-[[1-[(4-chlorophenyl)methyl]-2,7-dimethylindol-3-yl]methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one (PubChem CID 126043508) has the molecular formula C28H19ClF5N3O and a molecular weight of 543.92 g/mol. Its IUPAC name is (4E)-4-[[1-[(4-chlorophenyl)methyl]-2,7-dimethylindol-3-yl]methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one.
| Compound Name | (4E)-4-[[1-[(4-chlorophenyl)methyl]-2,7-dimethylindol-3-yl]methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one |
|---|---|
| PubChem CID | 126043508 |
| Molecular Formula | C28H19ClF5N3O |
| Molecular Weight | 543.92 g/mol |
| Exact Mass | 543.11 |
| IUPAC Name | (4E)-4-[[1-[(4-chlorophenyl)methyl]-2,7-dimethylindol-3-yl]methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one |
| SMILES | CC1=NN(c2c(F)c(F)c(F)c(F)c2F)C(=O)/C1=C/c1c(C)n(Cc2ccc(Cl)cc2)c2c(C)cccc12 |
| InChI | InChI=1S/C28H19ClF5N3O/c1-13-5-4-6-18-20(15(3)36(26(13)18)12-16-7-9-17(29)10-8-16)11-19-14(2)35-37(28(19)38)27-24(33)22(31)21(30)23(32)25(27)34/h4-11H,12H2,1-3H3/b19-11+ |
| InChIKey | XKAALLMIOVTOGY-YBFXNURJSA-N |
| XLogP | 7.46 |
| TPSA | 37.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.92 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|