C26H15ClF5N3O — CID 126043733
(4Z)-4-[[1-[(4-chlorophenyl)methyl]indol-3-yl]methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one (PubChem CID 126043733) has the molecular formula C26H15ClF5N3O and a molecular weight of 515.87 g/mol. Its IUPAC name is (4Z)-4-[[1-[(4-chlorophenyl)methyl]indol-3-yl]methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one.
| Compound Name | (4Z)-4-[[1-[(4-chlorophenyl)methyl]indol-3-yl]methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one |
|---|---|
| PubChem CID | 126043733 |
| Molecular Formula | C26H15ClF5N3O |
| Molecular Weight | 515.87 g/mol |
| Exact Mass | 515.08 |
| IUPAC Name | (4Z)-4-[[1-[(4-chlorophenyl)methyl]indol-3-yl]methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one |
| SMILES | CC1=NN(c2c(F)c(F)c(F)c(F)c2F)C(=O)/C1=C\c1cn(Cc2ccc(Cl)cc2)c2ccccc12 |
| InChI | InChI=1S/C26H15ClF5N3O/c1-13-18(26(36)35(33-13)25-23(31)21(29)20(28)22(30)24(25)32)10-15-12-34(19-5-3-2-4-17(15)19)11-14-6-8-16(27)9-7-14/h2-10,12H,11H2,1H3/b18-10- |
| InChIKey | MVEFKUFKTOYTHK-ZDLGFXPLSA-N |
| XLogP | 6.84 |
| TPSA | 37.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.87 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|