C15H7F5N2OS — CID 126040978
(4E)-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)-4-(thiophen-2-ylmethylidene)pyrazol-3-one (PubChem CID 126040978) has the molecular formula C15H7F5N2OS and a molecular weight of 358.29 g/mol. Its IUPAC name is (4E)-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)-4-(thiophen-2-ylmethylidene)pyrazol-3-one.
| Compound Name | (4E)-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)-4-(thiophen-2-ylmethylidene)pyrazol-3-one |
|---|---|
| PubChem CID | 126040978 |
| Molecular Formula | C15H7F5N2OS |
| Molecular Weight | 358.29 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | (4E)-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)-4-(thiophen-2-ylmethylidene)pyrazol-3-one |
| SMILES | CC1=NN(c2c(F)c(F)c(F)c(F)c2F)C(=O)/C1=C/c1cccs1 |
| InChI | InChI=1S/C15H7F5N2OS/c1-6-8(5-7-3-2-4-24-7)15(23)22(21-6)14-12(19)10(17)9(16)11(18)13(14)20/h2-5H,1H3/b8-5+ |
| InChIKey | HLPPHQWUAUNUPU-VMPITWQZSA-N |
| XLogP | 4.25 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.29 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|