C18H11F5N2O3 — CID 137174104
(4E)-4-[(4-hydroxy-3-methoxyphenyl)methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one (PubChem CID 137174104) has the molecular formula C18H11F5N2O3 and a molecular weight of 398.29 g/mol. Its IUPAC name is (4E)-4-[(4-hydroxy-3-methoxyphenyl)methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one.
| Compound Name | (4E)-4-[(4-hydroxy-3-methoxyphenyl)methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one |
|---|---|
| PubChem CID | 137174104 |
| Molecular Formula | C18H11F5N2O3 |
| Molecular Weight | 398.29 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | (4E)-4-[(4-hydroxy-3-methoxyphenyl)methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one |
| SMILES | COc1cc(/C=C2/C(=O)N(c3c(F)c(F)c(F)c(F)c3F)N=C2C)ccc1O |
| InChI | InChI=1S/C18H11F5N2O3/c1-7-9(5-8-3-4-10(26)11(6-8)28-2)18(27)25(24-7)17-15(22)13(20)12(19)14(21)16(17)23/h3-6,26H,1-2H3/b9-5+ |
| InChIKey | QMRKWKJVTZTJGC-WEVVVXLNSA-N |
| XLogP | 3.90 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.29 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|