C21H14F5IN2O5 — CID 126049939
methyl 2-[2-iodo-6-methoxy-4-[(E)-[3-methyl-5-oxo-1-(2,3,4,5,6-pentafluorophenyl)pyrazol-4-ylidene]methyl]phenoxy]acetate (PubChem CID 126049939) has the molecular formula C21H14F5IN2O5 and a molecular weight of 596.25 g/mol. Its IUPAC name is methyl 2-[2-iodo-6-methoxy-4-[(E)-[3-methyl-5-oxo-1-(2,3,4,5,6-pentafluorophenyl)pyrazol-4-ylidene]methyl]phenoxy]acetate.
| Compound Name | methyl 2-[2-iodo-6-methoxy-4-[(E)-[3-methyl-5-oxo-1-(2,3,4,5,6-pentafluorophenyl)pyrazol-4-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126049939 |
| Molecular Formula | C21H14F5IN2O5 |
| Molecular Weight | 596.25 g/mol |
| Exact Mass | 595.99 |
| IUPAC Name | methyl 2-[2-iodo-6-methoxy-4-[(E)-[3-methyl-5-oxo-1-(2,3,4,5,6-pentafluorophenyl)pyrazol-4-ylidene]methyl]phenoxy]acetate |
| SMILES | COC(=O)COc1c(I)cc(/C=C2/C(=O)N(c3c(F)c(F)c(F)c(F)c3F)N=C2C)cc1OC |
| InChI | InChI=1S/C21H14F5IN2O5/c1-8-10(4-9-5-11(27)20(12(6-9)32-2)34-7-13(30)33-3)21(31)29(28-8)19-17(25)15(23)14(22)16(24)18(19)26/h4-6H,7H2,1-3H3/b10-4+ |
| InChIKey | MTJYTTXKVDPEHQ-ONNFQVAWSA-N |
| XLogP | 4.35 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.25 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|