C24H12F6I2N2O2 — CID 126055745
(4E)-4-[[4-[(4-fluorophenyl)methoxy]-3,5-diiodophenyl]methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one (PubChem CID 126055745) has the molecular formula C24H12F6I2N2O2 and a molecular weight of 728.17 g/mol. Its IUPAC name is (4E)-4-[[4-[(4-fluorophenyl)methoxy]-3,5-diiodophenyl]methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one.
| Compound Name | (4E)-4-[[4-[(4-fluorophenyl)methoxy]-3,5-diiodophenyl]methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one |
|---|---|
| PubChem CID | 126055745 |
| Molecular Formula | C24H12F6I2N2O2 |
| Molecular Weight | 728.17 g/mol |
| Exact Mass | 727.89 |
| IUPAC Name | (4E)-4-[[4-[(4-fluorophenyl)methoxy]-3,5-diiodophenyl]methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one |
| SMILES | CC1=NN(c2c(F)c(F)c(F)c(F)c2F)C(=O)/C1=C/c1cc(I)c(OCc2ccc(F)cc2)c(I)c1 |
| InChI | InChI=1S/C24H12F6I2N2O2/c1-10-14(24(35)34(33-10)22-20(29)18(27)17(26)19(28)21(22)30)6-12-7-15(31)23(16(32)8-12)36-9-11-2-4-13(25)5-3-11/h2-8H,9H2,1H3/b14-6+ |
| InChIKey | QJGSSTOPJAZMST-MKMNVTDBSA-N |
| XLogP | 7.12 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.17 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|