C25H15BrF5IN2O3 — CID 126045164
(4Z)-4-[[2-[(4-bromophenyl)methoxy]-5-iodo-3-methoxyphenyl]methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one (PubChem CID 126045164) has the molecular formula C25H15BrF5IN2O3 and a molecular weight of 693.20 g/mol. Its IUPAC name is (4Z)-4-[[2-[(4-bromophenyl)methoxy]-5-iodo-3-methoxyphenyl]methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one.
| Compound Name | (4Z)-4-[[2-[(4-bromophenyl)methoxy]-5-iodo-3-methoxyphenyl]methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one |
|---|---|
| PubChem CID | 126045164 |
| Molecular Formula | C25H15BrF5IN2O3 |
| Molecular Weight | 693.20 g/mol |
| Exact Mass | 691.92 |
| IUPAC Name | (4Z)-4-[[2-[(4-bromophenyl)methoxy]-5-iodo-3-methoxyphenyl]methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one |
| SMILES | COc1cc(I)cc(/C=C2\C(=O)N(c3c(F)c(F)c(F)c(F)c3F)N=C2C)c1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C25H15BrF5IN2O3/c1-11-16(25(35)34(33-11)23-21(30)19(28)18(27)20(29)22(23)31)8-13-7-15(32)9-17(36-2)24(13)37-10-12-3-5-14(26)6-4-12/h3-9H,10H2,1-2H3/b16-8- |
| InChIKey | VREKKBRFUIHCOJ-PXNMLYILSA-N |
| XLogP | 7.14 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.20 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|